About 5-[(2-methylphenyl)methyl]-1,2-thiazol-4-amine
5-[(2-methylphenyl)methyl]-1,2-thiazol-4-amine (PubChem CID 112709064) has the molecular formula C11H12N2S
and a molecular weight of 204.30 g/mol. Its IUPAC name is 5-[(2-methylphenyl)methyl]-1,2-thiazol-4-amine.
Molecular Properties
| Compound Name | 5-[(2-methylphenyl)methyl]-1,2-thiazol-4-amine |
| PubChem CID | 112709064 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 5-[(2-methylphenyl)methyl]-1,2-thiazol-4-amine |
| SMILES | Cc1ccccc1Cc1sncc1N |
| InChI | InChI=1S/C11H12N2S/c1-8-4-2-3-5-9(8)6-11-10(12)7-13-14-11/h2-5,7H,6,12H2,1H3 |
| InChIKey | CPBBCCBKDRQUPG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(2-methylphenyl)methyl]-1,2-thiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-methylphenyl)methyl]-1,2-thiazol-4-amine?
The IUPAC name of 5-[(2-methylphenyl)methyl]-1,2-thiazol-4-amine (CID 112709064) is 5-[(2-methylphenyl)methyl]-1,2-thiazol-4-amine.
What is the SMILES notation for 5-[(2-methylphenyl)methyl]-1,2-thiazol-4-amine?
The canonical SMILES for 5-[(2-methylphenyl)methyl]-1,2-thiazol-4-amine is Cc1ccccc1Cc1sncc1N.
What is the InChIKey of 5-[(2-methylphenyl)methyl]-1,2-thiazol-4-amine?
The InChIKey is CPBBCCBKDRQUPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2S/c1-8-4-2-3-5-9(8)6-11-10(12)7-13-14-11/h2-5,7H,6,12H2,1H3.
What are the key properties of 5-[(2-methylphenyl)methyl]-1,2-thiazol-4-amine?
5-[(2-methylphenyl)methyl]-1,2-thiazol-4-amine has a molecular weight of 204.30 g/mol, XLogP of 2.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-methylphenyl)methyl]-1,2-thiazol-4-amine is sourced from PubChem (CID 112709064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).