C13H15N3 — CID 112710554
3-benzyl-2-methyl-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole (PubChem CID 112710554) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-benzyl-2-methyl-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole.
| Compound Name | 3-benzyl-2-methyl-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole |
|---|---|
| PubChem CID | 112710554 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 3-benzyl-2-methyl-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole |
| SMILES | Cn1nc2c(c1Cc1ccccc1)CNC2 |
| InChI | InChI=1S/C13H15N3/c1-16-13(7-10-5-3-2-4-6-10)11-8-14-9-12(11)15-16/h2-6,14H,7-9H2,1H3 |
| InChIKey | JDRVZGDMDUNLAJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |