C20H17N3 — CID 68557749
8-benzyl-4,7,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11,13,15-hexaene (PubChem CID 68557749) has the molecular formula C20H17N3 and a molecular weight of 299.38 g/mol. Its IUPAC name is 8-benzyl-4,7,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11,13,15-hexaene.
| Compound Name | 8-benzyl-4,7,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11,13,15-hexaene |
|---|---|
| PubChem CID | 68557749 |
| Molecular Formula | C20H17N3 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 8-benzyl-4,7,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11,13,15-hexaene |
| SMILES | c1ccc(Cc2nc3c(c4c2[nH]c2ccccc24)CNC3)cc1 |
| InChI | InChI=1S/C20H17N3/c1-2-6-13(7-3-1)10-17-20-19(15-11-21-12-18(15)22-17)14-8-4-5-9-16(14)23-20/h1-9,21,23H,10-12H2 |
| InChIKey | WEZOVIJGHSLKNF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |