About 2-morpholin-4-yl-1,3-oxazole-5-carboximidamide
2-morpholin-4-yl-1,3-oxazole-5-carboximidamide (PubChem CID 112712973) has the molecular formula C8H12N4O2
and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-morpholin-4-yl-1,3-oxazole-5-carboximidamide.
Molecular Properties
| Compound Name | 2-morpholin-4-yl-1,3-oxazole-5-carboximidamide |
| PubChem CID | 112712973 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 2-morpholin-4-yl-1,3-oxazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1cnc(N2CCOCC2)o1 |
| InChI | InChI=1S/C8H12N4O2/c9-7(10)6-5-11-8(14-6)12-1-3-13-4-2-12/h5H,1-4H2,(H3,9,10) |
| InChIKey | YXSPXLRWOKZPSX-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-morpholin-4-yl-1,3-oxazole-5-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-yl-1,3-oxazole-5-carboximidamide?
The IUPAC name of 2-morpholin-4-yl-1,3-oxazole-5-carboximidamide (CID 112712973) is 2-morpholin-4-yl-1,3-oxazole-5-carboximidamide.
What is the SMILES notation for 2-morpholin-4-yl-1,3-oxazole-5-carboximidamide?
The canonical SMILES for 2-morpholin-4-yl-1,3-oxazole-5-carboximidamide is [H]/N=C(\N)c1cnc(N2CCOCC2)o1.
What is the InChIKey of 2-morpholin-4-yl-1,3-oxazole-5-carboximidamide?
The InChIKey is YXSPXLRWOKZPSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O2/c9-7(10)6-5-11-8(14-6)12-1-3-13-4-2-12/h5H,1-4H2,(H3,9,10).
What are the key properties of 2-morpholin-4-yl-1,3-oxazole-5-carboximidamide?
2-morpholin-4-yl-1,3-oxazole-5-carboximidamide has a molecular weight of 196.21 g/mol, XLogP of -0.20, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-yl-1,3-oxazole-5-carboximidamide is sourced from PubChem (CID 112712973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).