C24H28N6O6 — CID 11271921
benzyl N-[1-[[1-[2-(2-amino-2-oxoethyl)-2-[(E)-3-pyridin-3-ylprop-2-enoyl]hydrazinyl]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 11271921) has the molecular formula C24H28N6O6 and a molecular weight of 496.52 g/mol. Its IUPAC name is benzyl N-[1-[[1-[2-(2-amino-2-oxoethyl)-2-[(E)-3-pyridin-3-ylprop-2-enoyl]hydrazinyl]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[[1-[2-(2-amino-2-oxoethyl)-2-[(E)-3-pyridin-3-ylprop-2-enoyl]hydrazinyl]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 11271921 |
| Molecular Formula | C24H28N6O6 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | benzyl N-[1-[[1-[2-(2-amino-2-oxoethyl)-2-[(E)-3-pyridin-3-ylprop-2-enoyl]hydrazinyl]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(NC(=O)OCc1ccccc1)C(=O)NC(C)C(=O)NN(CC(N)=O)C(=O)/C=C/c1cccnc1 |
| InChI | InChI=1S/C24H28N6O6/c1-16(28-24(35)36-15-19-7-4-3-5-8-19)22(33)27-17(2)23(34)29-30(14-20(25)31)21(32)11-10-18-9-6-12-26-13-18/h3-13,16-17H,14-15H2,1-2H3,(H2,25,31)(H,27,33)(H,28,35)(H,29,34)/b11-10+ |
| InChIKey | RHCRJZLHPCZVTB-ZHACJKMWSA-N |
| XLogP | 0.26 |
| TPSA | 172.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|