C22H29N5O8 — CID 72787741
ethyl 4-[(2-amino-2-oxoethyl)-[2-[2-(phenylmethoxycarbonylamino)propanoylamino]propanoylamino]amino]-4-oxobut-2-enoate (PubChem CID 72787741) has the molecular formula C22H29N5O8 and a molecular weight of 491.50 g/mol. Its IUPAC name is ethyl 4-[(2-amino-2-oxoethyl)-[2-[2-(phenylmethoxycarbonylamino)propanoylamino]propanoylamino]amino]-4-oxobut-2-enoate.
| Compound Name | ethyl 4-[(2-amino-2-oxoethyl)-[2-[2-(phenylmethoxycarbonylamino)propanoylamino]propanoylamino]amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 72787741 |
| Molecular Formula | C22H29N5O8 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | ethyl 4-[(2-amino-2-oxoethyl)-[2-[2-(phenylmethoxycarbonylamino)propanoylamino]propanoylamino]amino]-4-oxobut-2-enoate |
| SMILES | CCOC(=O)C=CC(=O)N(CC(N)=O)NC(=O)C(C)NC(=O)C(C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H29N5O8/c1-4-34-19(30)11-10-18(29)27(12-17(23)28)26-21(32)15(3)24-20(31)14(2)25-22(33)35-13-16-8-6-5-7-9-16/h5-11,14-15H,4,12-13H2,1-3H3,(H2,23,28)(H,24,31)(H,25,33)(H,26,32) |
| InChIKey | YGVKPQSVBJEMMQ-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 186.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|