C24H33N7O7 — CID 45483332
benzyl (E)-4-[(2-amino-2-oxoethyl)-[[(2S)-2-[[(2R)-2-(piperazine-1-carbonylamino)propanoyl]amino]propanoyl]amino]amino]-4-oxobut-2-enoate (PubChem CID 45483332) has the molecular formula C24H33N7O7 and a molecular weight of 531.57 g/mol. Its IUPAC name is benzyl (E)-4-[(2-amino-2-oxoethyl)-[[(2S)-2-[[(2R)-2-(piperazine-1-carbonylamino)propanoyl]amino]propanoyl]amino]amino]-4-oxobut-2-enoate.
| Compound Name | benzyl (E)-4-[(2-amino-2-oxoethyl)-[[(2S)-2-[[(2R)-2-(piperazine-1-carbonylamino)propanoyl]amino]propanoyl]amino]amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 45483332 |
| Molecular Formula | C24H33N7O7 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | benzyl (E)-4-[(2-amino-2-oxoethyl)-[[(2S)-2-[[(2R)-2-(piperazine-1-carbonylamino)propanoyl]amino]propanoyl]amino]amino]-4-oxobut-2-enoate |
| SMILES | C[C@H](NC(=O)[C@@H](C)NC(=O)N1CCNCC1)C(=O)NN(CC(N)=O)C(=O)/C=C/C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H33N7O7/c1-16(28-24(37)30-12-10-26-11-13-30)22(35)27-17(2)23(36)29-31(14-19(25)32)20(33)8-9-21(34)38-15-18-6-4-3-5-7-18/h3-9,16-17,26H,10-15H2,1-2H3,(H2,25,32)(H,27,35)(H,28,37)(H,29,36)/b9-8+/t16-,17+/m1/s1 |
| InChIKey | ICFJNHPHRAUATE-LJFOUZCWSA-N |
| XLogP | -1.86 |
| TPSA | 192.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|