C8H9Cl2NO2 — CID 112725038
propan-2-yl 4,5-dichloro-1H-pyrrole-2-carboxylate (PubChem CID 112725038) has the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. Its IUPAC name is propan-2-yl 4,5-dichloro-1H-pyrrole-2-carboxylate.
| Compound Name | propan-2-yl 4,5-dichloro-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 112725038 |
| Molecular Formula | C8H9Cl2NO2 |
| Molecular Weight | 222.07 g/mol |
| Exact Mass | 221.00 |
| IUPAC Name | propan-2-yl 4,5-dichloro-1H-pyrrole-2-carboxylate |
| SMILES | CC(C)OC(=O)c1cc(Cl)c(Cl)[nH]1 |
| InChI | InChI=1S/C8H9Cl2NO2/c1-4(2)13-8(12)6-3-5(9)7(10)11-6/h3-4,11H,1-2H3 |
| InChIKey | NTDBGYLBSUHJEO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.07 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |