C10H10FNO3 — CID 70885158
propan-2-yl 3-fluoro-4H-furo[3,2-b]pyrrole-5-carboxylate (PubChem CID 70885158) has the molecular formula C10H10FNO3 and a molecular weight of 211.19 g/mol. Its IUPAC name is propan-2-yl 3-fluoro-4H-furo[3,2-b]pyrrole-5-carboxylate.
| Compound Name | propan-2-yl 3-fluoro-4H-furo[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 70885158 |
| Molecular Formula | C10H10FNO3 |
| Molecular Weight | 211.19 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | propan-2-yl 3-fluoro-4H-furo[3,2-b]pyrrole-5-carboxylate |
| SMILES | CC(C)OC(=O)c1cc2occ(F)c2[nH]1 |
| InChI | InChI=1S/C10H10FNO3/c1-5(2)15-10(13)7-3-8-9(12-7)6(11)4-14-8/h3-5,12H,1-2H3 |
| InChIKey | MNDRZQVZKZOBFT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |