About ethane;propan-2-yl 2-fluoro-4H-furo[3,2-b]pyrrole-5-carboxylate
ethane;propan-2-yl 2-fluoro-4H-furo[3,2-b]pyrrole-5-carboxylate (PubChem CID 143939709) has the molecular formula C12H16FNO3
and a molecular weight of 241.26 g/mol. Its IUPAC name is ethane;propan-2-yl 2-fluoro-4H-furo[3,2-b]pyrrole-5-carboxylate.
Molecular Properties
| Compound Name | ethane;propan-2-yl 2-fluoro-4H-furo[3,2-b]pyrrole-5-carboxylate |
| PubChem CID | 143939709 |
| Molecular Formula | C12H16FNO3 |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | ethane;propan-2-yl 2-fluoro-4H-furo[3,2-b]pyrrole-5-carboxylate |
| SMILES | CC.CC(C)OC(=O)c1cc2oc(F)cc2[nH]1 |
| InChI | InChI=1S/C10H10FNO3.C2H6/c1-5(2)14-10(13)7-3-8-6(12-7)4-9(11)15-8;1-2/h3-5,12H,1-2H3;1-2H3 |
| InChIKey | ATTDPYGFQSJYLC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;propan-2-yl 2-fluoro-4H-furo[3,2-b]pyrrole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propan-2-yl 2-fluoro-4H-furo[3,2-b]pyrrole-5-carboxylate?
The IUPAC name of ethane;propan-2-yl 2-fluoro-4H-furo[3,2-b]pyrrole-5-carboxylate (CID 143939709) is ethane;propan-2-yl 2-fluoro-4H-furo[3,2-b]pyrrole-5-carboxylate.
What is the SMILES notation for ethane;propan-2-yl 2-fluoro-4H-furo[3,2-b]pyrrole-5-carboxylate?
The canonical SMILES for ethane;propan-2-yl 2-fluoro-4H-furo[3,2-b]pyrrole-5-carboxylate is CC.CC(C)OC(=O)c1cc2oc(F)cc2[nH]1.
What is the InChIKey of ethane;propan-2-yl 2-fluoro-4H-furo[3,2-b]pyrrole-5-carboxylate?
The InChIKey is ATTDPYGFQSJYLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO3.C2H6/c1-5(2)14-10(13)7-3-8-6(12-7)4-9(11)15-8;1-2/h3-5,12H,1-2H3;1-2H3.
What are the key properties of ethane;propan-2-yl 2-fluoro-4H-furo[3,2-b]pyrrole-5-carboxylate?
ethane;propan-2-yl 2-fluoro-4H-furo[3,2-b]pyrrole-5-carboxylate has a molecular weight of 241.26 g/mol, XLogP of 3.49, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propan-2-yl 2-fluoro-4H-furo[3,2-b]pyrrole-5-carboxylate is sourced from PubChem (CID 143939709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).