C12H13NO5 — CID 58134017
1-propanoyloxyethyl 4H-furo[3,2-b]pyrrole-5-carboxylate (PubChem CID 58134017) has the molecular formula C12H13NO5 and a molecular weight of 251.24 g/mol. Its IUPAC name is 1-propanoyloxyethyl 4H-furo[3,2-b]pyrrole-5-carboxylate.
| Compound Name | 1-propanoyloxyethyl 4H-furo[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 58134017 |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 1-propanoyloxyethyl 4H-furo[3,2-b]pyrrole-5-carboxylate |
| SMILES | CCC(=O)OC(C)OC(=O)c1cc2occc2[nH]1 |
| InChI | InChI=1S/C12H13NO5/c1-3-11(14)17-7(2)18-12(15)9-6-10-8(13-9)4-5-16-10/h4-7,13H,3H2,1-2H3 |
| InChIKey | VXWGOUIDOGJLRF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 81.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|