C11H14N2O4 — CID 123140497
[hydroxy(propylamino)methyl] 4H-furo[3,2-b]pyrrole-5-carboxylate (PubChem CID 123140497) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is [hydroxy(propylamino)methyl] 4H-furo[3,2-b]pyrrole-5-carboxylate.
| Compound Name | [hydroxy(propylamino)methyl] 4H-furo[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 123140497 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | [hydroxy(propylamino)methyl] 4H-furo[3,2-b]pyrrole-5-carboxylate |
| SMILES | CCCNC(O)OC(=O)c1cc2occc2[nH]1 |
| InChI | InChI=1S/C11H14N2O4/c1-2-4-12-11(15)17-10(14)8-6-9-7(13-8)3-5-16-9/h3,5-6,11-13,15H,2,4H2,1H3 |
| InChIKey | XOCHBUBNQFONNE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|