C21H22N2O6 — CID 88977130
[1-[4-(3-amino-2-oxopropyl)benzoyl]oxy-2-methylpropyl] 4H-furo[3,2-b]pyrrole-5-carboxylate (PubChem CID 88977130) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is [1-[4-(3-amino-2-oxopropyl)benzoyl]oxy-2-methylpropyl] 4H-furo[3,2-b]pyrrole-5-carboxylate.
| Compound Name | [1-[4-(3-amino-2-oxopropyl)benzoyl]oxy-2-methylpropyl] 4H-furo[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 88977130 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | [1-[4-(3-amino-2-oxopropyl)benzoyl]oxy-2-methylpropyl] 4H-furo[3,2-b]pyrrole-5-carboxylate |
| SMILES | CC(C)C(OC(=O)c1ccc(CC(=O)CN)cc1)OC(=O)c1cc2occc2[nH]1 |
| InChI | InChI=1S/C21H22N2O6/c1-12(2)21(29-20(26)17-10-18-16(23-17)7-8-27-18)28-19(25)14-5-3-13(4-6-14)9-15(24)11-22/h3-8,10,12,21,23H,9,11,22H2,1-2H3 |
| InChIKey | GPWQUYUCMDMRGE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 124.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|