C12H7NO5 — CID 175517065
(4-oxopyran-3-yl) 4H-furo[3,2-b]pyrrole-5-carboxylate (PubChem CID 175517065) has the molecular formula C12H7NO5 and a molecular weight of 245.19 g/mol. Its IUPAC name is (4-oxopyran-3-yl) 4H-furo[3,2-b]pyrrole-5-carboxylate.
| Compound Name | (4-oxopyran-3-yl) 4H-furo[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 175517065 |
| Molecular Formula | C12H7NO5 |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | (4-oxopyran-3-yl) 4H-furo[3,2-b]pyrrole-5-carboxylate |
| SMILES | O=C(Oc1coccc1=O)c1cc2occc2[nH]1 |
| InChI | InChI=1S/C12H7NO5/c14-9-2-3-16-6-11(9)18-12(15)8-5-10-7(13-8)1-4-17-10/h1-6,13H |
| InChIKey | CHTJEKLDPPUSSN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |