About (4-oxopyran-3-yl) 4H-furo[3,2-b]pyrrole-5-carboxylate
(4-oxopyran-3-yl) 4H-furo[3,2-b]pyrrole-5-carboxylate (PubChem CID 175517065) has the molecular formula C12H7NO5
and a molecular weight of 245.19 g/mol. Its IUPAC name is (4-oxopyran-3-yl) 4H-furo[3,2-b]pyrrole-5-carboxylate.
Molecular Properties
| Compound Name | (4-oxopyran-3-yl) 4H-furo[3,2-b]pyrrole-5-carboxylate |
| PubChem CID | 175517065 |
| Molecular Formula | C12H7NO5 |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | (4-oxopyran-3-yl) 4H-furo[3,2-b]pyrrole-5-carboxylate |
| SMILES | O=C(Oc1coccc1=O)c1cc2occc2[nH]1 |
| InChI | InChI=1S/C12H7NO5/c14-9-2-3-16-6-11(9)18-12(15)8-5-10-7(13-8)1-4-17-10/h1-6,13H |
| InChIKey | CHTJEKLDPPUSSN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-oxopyran-3-yl) 4H-furo[3,2-b]pyrrole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxopyran-3-yl) 4H-furo[3,2-b]pyrrole-5-carboxylate?
The IUPAC name of (4-oxopyran-3-yl) 4H-furo[3,2-b]pyrrole-5-carboxylate (CID 175517065) is (4-oxopyran-3-yl) 4H-furo[3,2-b]pyrrole-5-carboxylate.
What is the SMILES notation for (4-oxopyran-3-yl) 4H-furo[3,2-b]pyrrole-5-carboxylate?
The canonical SMILES for (4-oxopyran-3-yl) 4H-furo[3,2-b]pyrrole-5-carboxylate is O=C(Oc1coccc1=O)c1cc2occc2[nH]1.
What is the InChIKey of (4-oxopyran-3-yl) 4H-furo[3,2-b]pyrrole-5-carboxylate?
The InChIKey is CHTJEKLDPPUSSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7NO5/c14-9-2-3-16-6-11(9)18-12(15)8-5-10-7(13-8)1-4-17-10/h1-6,13H.
What are the key properties of (4-oxopyran-3-yl) 4H-furo[3,2-b]pyrrole-5-carboxylate?
(4-oxopyran-3-yl) 4H-furo[3,2-b]pyrrole-5-carboxylate has a molecular weight of 245.19 g/mol, XLogP of 1.93, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxopyran-3-yl) 4H-furo[3,2-b]pyrrole-5-carboxylate is sourced from PubChem (CID 175517065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).