C11H11NO6 — CID 58134140
ethoxycarbonyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate (PubChem CID 58134140) has the molecular formula C11H11NO6 and a molecular weight of 253.21 g/mol. Its IUPAC name is ethoxycarbonyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate.
| Compound Name | ethoxycarbonyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 58134140 |
| Molecular Formula | C11H11NO6 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | ethoxycarbonyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)OCOC(=O)c1cc2occc2[nH]1 |
| InChI | InChI=1S/C11H11NO6/c1-2-15-11(14)18-6-17-10(13)8-5-9-7(12-8)3-4-16-9/h3-5,12H,2,6H2,1H3 |
| InChIKey | SMPYOFWHQZVPGS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|