C11H13NO5 — CID 123865378
ethoxymethoxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate (PubChem CID 123865378) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is ethoxymethoxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate.
| Compound Name | ethoxymethoxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 123865378 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | ethoxymethoxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate |
| SMILES | CCOCOCOC(=O)c1cc2occc2[nH]1 |
| InChI | InChI=1S/C11H13NO5/c1-2-14-6-15-7-17-11(13)9-5-10-8(12-9)3-4-16-10/h3-5,12H,2,6-7H2,1H3 |
| InChIKey | LJGWDCRVBMYYME-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|