C10H11NO5 — CID 143939741
acetyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate;molecular hydrogen (PubChem CID 143939741) has the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. Its IUPAC name is acetyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate;molecular hydrogen.
| Compound Name | acetyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate;molecular hydrogen |
|---|---|
| PubChem CID | 143939741 |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | acetyloxymethyl 4H-furo[3,2-b]pyrrole-5-carboxylate;molecular hydrogen |
| SMILES | CC(=O)OCOC(=O)c1cc2occc2[nH]1.[H][H] |
| InChI | InChI=1S/C10H9NO5.H2/c1-6(12)15-5-16-10(13)8-4-9-7(11-8)2-3-14-9;/h2-4,11H,5H2,1H3;1H |
| InChIKey | RZJNXFZVWJODDY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 81.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|