C17H24N2O6 — CID 143939713
ethane;2-(2-morpholin-4-ylacetyl)oxyethyl 4H-furo[3,2-b]pyrrole-5-carboxylate (PubChem CID 143939713) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is ethane;2-(2-morpholin-4-ylacetyl)oxyethyl 4H-furo[3,2-b]pyrrole-5-carboxylate.
| Compound Name | ethane;2-(2-morpholin-4-ylacetyl)oxyethyl 4H-furo[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 143939713 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | ethane;2-(2-morpholin-4-ylacetyl)oxyethyl 4H-furo[3,2-b]pyrrole-5-carboxylate |
| SMILES | CC.O=C(CN1CCOCC1)OCCOC(=O)c1cc2occc2[nH]1 |
| InChI | InChI=1S/C15H18N2O6.C2H6/c18-14(10-17-2-5-20-6-3-17)22-7-8-23-15(19)12-9-13-11(16-12)1-4-21-13;1-2/h1,4,9,16H,2-3,5-8,10H2;1-2H3 |
| InChIKey | WHZFMPMTSBXDPU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 94.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|