C8H8NO6P — CID 58134130
[hydroxy(methoxy)phosphoryl] 4H-furo[3,2-b]pyrrole-5-carboxylate (PubChem CID 58134130) has the molecular formula C8H8NO6P and a molecular weight of 245.13 g/mol. Its IUPAC name is [hydroxy(methoxy)phosphoryl] 4H-furo[3,2-b]pyrrole-5-carboxylate.
| Compound Name | [hydroxy(methoxy)phosphoryl] 4H-furo[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 58134130 |
| Molecular Formula | C8H8NO6P |
| Molecular Weight | 245.13 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | [hydroxy(methoxy)phosphoryl] 4H-furo[3,2-b]pyrrole-5-carboxylate |
| SMILES | COP(=O)(O)OC(=O)c1cc2occc2[nH]1 |
| InChI | InChI=1S/C8H8NO6P/c1-13-16(11,12)15-8(10)6-4-7-5(9-6)2-3-14-7/h2-4,9H,1H3,(H,11,12) |
| InChIKey | WCUNXIHZPRHAMX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 101.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.13 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|