About 1-(2-chloro-4-fluoro-5-methylphenyl)-2,5,5-trimethylpiperazine
1-(2-chloro-4-fluoro-5-methylphenyl)-2,5,5-trimethylpiperazine (PubChem CID 112734719) has the molecular formula C14H20ClFN2
and a molecular weight of 270.78 g/mol. Its IUPAC name is 1-(2-chloro-4-fluoro-5-methylphenyl)-2,5,5-trimethylpiperazine.
Molecular Properties
| Compound Name | 1-(2-chloro-4-fluoro-5-methylphenyl)-2,5,5-trimethylpiperazine |
| PubChem CID | 112734719 |
| Molecular Formula | C14H20ClFN2 |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 1-(2-chloro-4-fluoro-5-methylphenyl)-2,5,5-trimethylpiperazine |
| SMILES | Cc1cc(N2CC(C)(C)NCC2C)c(Cl)cc1F |
| InChI | InChI=1S/C14H20ClFN2/c1-9-5-13(11(15)6-12(9)16)18-8-14(3,4)17-7-10(18)2/h5-6,10,17H,7-8H2,1-4H3 |
| InChIKey | ISICFBLAGWQNSE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-chloro-4-fluoro-5-methylphenyl)-2,5,5-trimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloro-4-fluoro-5-methylphenyl)-2,5,5-trimethylpiperazine?
The IUPAC name of 1-(2-chloro-4-fluoro-5-methylphenyl)-2,5,5-trimethylpiperazine (CID 112734719) is 1-(2-chloro-4-fluoro-5-methylphenyl)-2,5,5-trimethylpiperazine.
What is the SMILES notation for 1-(2-chloro-4-fluoro-5-methylphenyl)-2,5,5-trimethylpiperazine?
The canonical SMILES for 1-(2-chloro-4-fluoro-5-methylphenyl)-2,5,5-trimethylpiperazine is Cc1cc(N2CC(C)(C)NCC2C)c(Cl)cc1F.
What is the InChIKey of 1-(2-chloro-4-fluoro-5-methylphenyl)-2,5,5-trimethylpiperazine?
The InChIKey is ISICFBLAGWQNSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClFN2/c1-9-5-13(11(15)6-12(9)16)18-8-14(3,4)17-7-10(18)2/h5-6,10,17H,7-8H2,1-4H3.
What are the key properties of 1-(2-chloro-4-fluoro-5-methylphenyl)-2,5,5-trimethylpiperazine?
1-(2-chloro-4-fluoro-5-methylphenyl)-2,5,5-trimethylpiperazine has a molecular weight of 270.78 g/mol, XLogP of 3.36, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloro-4-fluoro-5-methylphenyl)-2,5,5-trimethylpiperazine is sourced from PubChem (CID 112734719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).