About 2-(3-methylcyclohexyl)oxy-4-azatricyclo[4.2.1.03,7]nonane
2-(3-methylcyclohexyl)oxy-4-azatricyclo[4.2.1.03,7]nonane (PubChem CID 112747579) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-(3-methylcyclohexyl)oxy-4-azatricyclo[4.2.1.03,7]nonane.
Analyze 2-(3-methylcyclohexyl)oxy-4-azatricyclo[4.2.1.03,7]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylcyclohexyl)oxy-4-azatricyclo[4.2.1.03,7]nonane?
The IUPAC name of 2-(3-methylcyclohexyl)oxy-4-azatricyclo[4.2.1.03,7]nonane (CID 112747579) is 2-(3-methylcyclohexyl)oxy-4-azatricyclo[4.2.1.03,7]nonane.
What is the SMILES notation for 2-(3-methylcyclohexyl)oxy-4-azatricyclo[4.2.1.03,7]nonane?
The canonical SMILES for 2-(3-methylcyclohexyl)oxy-4-azatricyclo[4.2.1.03,7]nonane is CC1CCCC(OC2C3CC4CNC2C4C3)C1.
What is the InChIKey of 2-(3-methylcyclohexyl)oxy-4-azatricyclo[4.2.1.03,7]nonane?
The InChIKey is QJICQCXNQVMVMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO/c1-9-3-2-4-12(5-9)17-15-10-6-11-8-16-14(15)13(11)7-10/h9-16H,2-8H2,1H3.
What are the key properties of 2-(3-methylcyclohexyl)oxy-4-azatricyclo[4.2.1.03,7]nonane?
2-(3-methylcyclohexyl)oxy-4-azatricyclo[4.2.1.03,7]nonane has a molecular weight of 235.37 g/mol, XLogP of 2.58, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylcyclohexyl)oxy-4-azatricyclo[4.2.1.03,7]nonane is sourced from PubChem (CID 112747579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).