About 2-cycloheptyloxy-4-azatricyclo[4.2.1.03,7]nonane
2-cycloheptyloxy-4-azatricyclo[4.2.1.03,7]nonane (PubChem CID 112747563) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-cycloheptyloxy-4-azatricyclo[4.2.1.03,7]nonane.
Molecular Properties
| Compound Name | 2-cycloheptyloxy-4-azatricyclo[4.2.1.03,7]nonane |
| PubChem CID | 112747563 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 2-cycloheptyloxy-4-azatricyclo[4.2.1.03,7]nonane |
| SMILES | C1CCCC(OC2C3CC4CNC2C4C3)CC1 |
| InChI | InChI=1S/C15H25NO/c1-2-4-6-12(5-3-1)17-15-10-7-11-9-16-14(15)13(11)8-10/h10-16H,1-9H2 |
| InChIKey | NNUBZOKDTSBEJJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cycloheptyloxy-4-azatricyclo[4.2.1.03,7]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cycloheptyloxy-4-azatricyclo[4.2.1.03,7]nonane?
The IUPAC name of 2-cycloheptyloxy-4-azatricyclo[4.2.1.03,7]nonane (CID 112747563) is 2-cycloheptyloxy-4-azatricyclo[4.2.1.03,7]nonane.
What is the SMILES notation for 2-cycloheptyloxy-4-azatricyclo[4.2.1.03,7]nonane?
The canonical SMILES for 2-cycloheptyloxy-4-azatricyclo[4.2.1.03,7]nonane is C1CCCC(OC2C3CC4CNC2C4C3)CC1.
What is the InChIKey of 2-cycloheptyloxy-4-azatricyclo[4.2.1.03,7]nonane?
The InChIKey is NNUBZOKDTSBEJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO/c1-2-4-6-12(5-3-1)17-15-10-7-11-9-16-14(15)13(11)8-10/h10-16H,1-9H2.
What are the key properties of 2-cycloheptyloxy-4-azatricyclo[4.2.1.03,7]nonane?
2-cycloheptyloxy-4-azatricyclo[4.2.1.03,7]nonane has a molecular weight of 235.37 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cycloheptyloxy-4-azatricyclo[4.2.1.03,7]nonane is sourced from PubChem (CID 112747563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).