C8H13F3O — CID 162553401
cis-(1R,3S)-1-methyl-3-(trifluoromethoxy)cyclohexane (PubChem CID 162553401) has the molecular formula C8H13F3O and a molecular weight of 182.18 g/mol. Its IUPAC name is cis-(1R,3S)-1-methyl-3-(trifluoromethoxy)cyclohexane.
| Compound Name | cis-(1R,3S)-1-methyl-3-(trifluoromethoxy)cyclohexane |
|---|---|
| PubChem CID | 162553401 |
| Molecular Formula | C8H13F3O |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | cis-(1R,3S)-1-methyl-3-(trifluoromethoxy)cyclohexane |
| SMILES | C[C@@H]1CCC[C@H](OC(F)(F)F)C1 |
| InChI | InChI=1S/C8H13F3O/c1-6-3-2-4-7(5-6)12-8(9,10)11/h6-7H,2-5H2,1H3/t6-,7+/m1/s1 |
| InChIKey | GEKHYFMZORHWRN-RQJHMYQMSA-N |
| XLogP | 3.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |