C7H12F3NO — CID 177313582
(2R,4S)-2-methyl-4-(trifluoromethoxy)piperidine (PubChem CID 177313582) has the molecular formula C7H12F3NO and a molecular weight of 183.17 g/mol. Its IUPAC name is (2R,4S)-2-methyl-4-(trifluoromethoxy)piperidine.
| Compound Name | (2R,4S)-2-methyl-4-(trifluoromethoxy)piperidine |
|---|---|
| PubChem CID | 177313582 |
| Molecular Formula | C7H12F3NO |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (2R,4S)-2-methyl-4-(trifluoromethoxy)piperidine |
| SMILES | C[C@@H]1C[C@@H](OC(F)(F)F)CCN1 |
| InChI | InChI=1S/C7H12F3NO/c1-5-4-6(2-3-11-5)12-7(8,9)10/h5-6,11H,2-4H2,1H3/t5-,6+/m1/s1 |
| InChIKey | GXEYAJMDVCNOQO-RITPCOANSA-N |
| XLogP | 1.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |