C14H23NO3 — CID 112752565
3-methoxy-N-[2-(2-methoxyethoxy)ethyl]-2,4-dimethylaniline (PubChem CID 112752565) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 3-methoxy-N-[2-(2-methoxyethoxy)ethyl]-2,4-dimethylaniline.
| Compound Name | 3-methoxy-N-[2-(2-methoxyethoxy)ethyl]-2,4-dimethylaniline |
|---|---|
| PubChem CID | 112752565 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 3-methoxy-N-[2-(2-methoxyethoxy)ethyl]-2,4-dimethylaniline |
| SMILES | COCCOCCNc1ccc(C)c(OC)c1C |
| InChI | InChI=1S/C14H23NO3/c1-11-5-6-13(12(2)14(11)17-4)15-7-8-18-10-9-16-3/h5-6,15H,7-10H2,1-4H3 |
| InChIKey | ZDDAJZWFFOSIPB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|