C15H19Br2NO — CID 112752910
N-[3-(bromomethyl)cyclohexyl]-2-(3-bromophenyl)acetamide (PubChem CID 112752910) has the molecular formula C15H19Br2NO and a molecular weight of 389.13 g/mol. Its IUPAC name is N-[3-(bromomethyl)cyclohexyl]-2-(3-bromophenyl)acetamide.
| Compound Name | N-[3-(bromomethyl)cyclohexyl]-2-(3-bromophenyl)acetamide |
|---|---|
| PubChem CID | 112752910 |
| Molecular Formula | C15H19Br2NO |
| Molecular Weight | 389.13 g/mol |
| Exact Mass | 386.98 |
| IUPAC Name | N-[3-(bromomethyl)cyclohexyl]-2-(3-bromophenyl)acetamide |
| SMILES | O=C(Cc1cccc(Br)c1)NC1CCCC(CBr)C1 |
| InChI | InChI=1S/C15H19Br2NO/c16-10-12-4-2-6-14(8-12)18-15(19)9-11-3-1-5-13(17)7-11/h1,3,5,7,12,14H,2,4,6,8-10H2,(H,18,19) |
| InChIKey | LVLAFLASNCECKI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.13 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|