About N-[3-(bromomethyl)cyclohexyl]-2,3-difluorobenzamide
N-[3-(bromomethyl)cyclohexyl]-2,3-difluorobenzamide (PubChem CID 112752885) has the molecular formula C14H16BrF2NO
and a molecular weight of 332.19 g/mol. Its IUPAC name is N-[3-(bromomethyl)cyclohexyl]-2,3-difluorobenzamide.
Molecular Properties
| Compound Name | N-[3-(bromomethyl)cyclohexyl]-2,3-difluorobenzamide |
| PubChem CID | 112752885 |
| Molecular Formula | C14H16BrF2NO |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | N-[3-(bromomethyl)cyclohexyl]-2,3-difluorobenzamide |
| SMILES | O=C(NC1CCCC(CBr)C1)c1cccc(F)c1F |
| InChI | InChI=1S/C14H16BrF2NO/c15-8-9-3-1-4-10(7-9)18-14(19)11-5-2-6-12(16)13(11)17/h2,5-6,9-10H,1,3-4,7-8H2,(H,18,19) |
| InChIKey | OGHFFSIIDNQKDK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(bromomethyl)cyclohexyl]-2,3-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(bromomethyl)cyclohexyl]-2,3-difluorobenzamide?
The IUPAC name of N-[3-(bromomethyl)cyclohexyl]-2,3-difluorobenzamide (CID 112752885) is N-[3-(bromomethyl)cyclohexyl]-2,3-difluorobenzamide.
What is the SMILES notation for N-[3-(bromomethyl)cyclohexyl]-2,3-difluorobenzamide?
The canonical SMILES for N-[3-(bromomethyl)cyclohexyl]-2,3-difluorobenzamide is O=C(NC1CCCC(CBr)C1)c1cccc(F)c1F.
What is the InChIKey of N-[3-(bromomethyl)cyclohexyl]-2,3-difluorobenzamide?
The InChIKey is OGHFFSIIDNQKDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16BrF2NO/c15-8-9-3-1-4-10(7-9)18-14(19)11-5-2-6-12(16)13(11)17/h2,5-6,9-10H,1,3-4,7-8H2,(H,18,19).
What are the key properties of N-[3-(bromomethyl)cyclohexyl]-2,3-difluorobenzamide?
N-[3-(bromomethyl)cyclohexyl]-2,3-difluorobenzamide has a molecular weight of 332.19 g/mol, XLogP of 3.65, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(bromomethyl)cyclohexyl]-2,3-difluorobenzamide is sourced from PubChem (CID 112752885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).