About (5-aminothieno[2,3-d]pyrimidin-6-yl)-morpholin-4-ylmethanone
(5-aminothieno[2,3-d]pyrimidin-6-yl)-morpholin-4-ylmethanone (PubChem CID 112755769) has the molecular formula C11H12N4O2S
and a molecular weight of 264.31 g/mol. Its IUPAC name is (5-aminothieno[2,3-d]pyrimidin-6-yl)-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | (5-aminothieno[2,3-d]pyrimidin-6-yl)-morpholin-4-ylmethanone |
| PubChem CID | 112755769 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | (5-aminothieno[2,3-d]pyrimidin-6-yl)-morpholin-4-ylmethanone |
| SMILES | Nc1c(C(=O)N2CCOCC2)sc2ncncc12 |
| InChI | InChI=1S/C11H12N4O2S/c12-8-7-5-13-6-14-10(7)18-9(8)11(16)15-1-3-17-4-2-15/h5-6H,1-4,12H2 |
| InChIKey | HBSKJSMLDXJKNB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5-aminothieno[2,3-d]pyrimidin-6-yl)-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-aminothieno[2,3-d]pyrimidin-6-yl)-morpholin-4-ylmethanone?
The IUPAC name of (5-aminothieno[2,3-d]pyrimidin-6-yl)-morpholin-4-ylmethanone (CID 112755769) is (5-aminothieno[2,3-d]pyrimidin-6-yl)-morpholin-4-ylmethanone.
What is the SMILES notation for (5-aminothieno[2,3-d]pyrimidin-6-yl)-morpholin-4-ylmethanone?
The canonical SMILES for (5-aminothieno[2,3-d]pyrimidin-6-yl)-morpholin-4-ylmethanone is Nc1c(C(=O)N2CCOCC2)sc2ncncc12.
What is the InChIKey of (5-aminothieno[2,3-d]pyrimidin-6-yl)-morpholin-4-ylmethanone?
The InChIKey is HBSKJSMLDXJKNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O2S/c12-8-7-5-13-6-14-10(7)18-9(8)11(16)15-1-3-17-4-2-15/h5-6H,1-4,12H2.
What are the key properties of (5-aminothieno[2,3-d]pyrimidin-6-yl)-morpholin-4-ylmethanone?
(5-aminothieno[2,3-d]pyrimidin-6-yl)-morpholin-4-ylmethanone has a molecular weight of 264.31 g/mol, XLogP of 0.75, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-aminothieno[2,3-d]pyrimidin-6-yl)-morpholin-4-ylmethanone is sourced from PubChem (CID 112755769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).