C8H14ClN — CID 112756806
(3aS,7aR)-2,3,3a,4,7,7a-hexahydro-1H-isoindole;hydrochloride (PubChem CID 112756806) has the molecular formula C8H14ClN and a molecular weight of 159.66 g/mol. Its IUPAC name is (3aS,7aR)-2,3,3a,4,7,7a-hexahydro-1H-isoindole;hydrochloride.
| Compound Name | (3aS,7aR)-2,3,3a,4,7,7a-hexahydro-1H-isoindole;hydrochloride |
|---|---|
| PubChem CID | 112756806 |
| Molecular Formula | C8H14ClN |
| Molecular Weight | 159.66 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | (3aS,7aR)-2,3,3a,4,7,7a-hexahydro-1H-isoindole;hydrochloride |
| SMILES | C1=CC[C@H]2CNC[C@H]2C1.Cl |
| InChI | InChI=1S/C8H13N.ClH/c1-2-4-8-6-9-5-7(8)3-1;/h1-2,7-9H,3-6H2;1H/t7-,8+; |
| InChIKey | LYWBZNCXQWATMG-KVZVIFLMSA-N |
| XLogP | 1.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.66 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|