C13H14N2O2S3 — CID 112759270
N-(6-methoxy-1,3-benzothiazol-2-yl)-1,4-dithiane-2-carboxamide (PubChem CID 112759270) has the molecular formula C13H14N2O2S3 and a molecular weight of 326.47 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-1,4-dithiane-2-carboxamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-1,4-dithiane-2-carboxamide |
|---|---|
| PubChem CID | 112759270 |
| Molecular Formula | C13H14N2O2S3 |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-1,4-dithiane-2-carboxamide |
| SMILES | COc1ccc2nc(NC(=O)C3CSCCS3)sc2c1 |
| InChI | InChI=1S/C13H14N2O2S3/c1-17-8-2-3-9-10(6-8)20-13(14-9)15-12(16)11-7-18-4-5-19-11/h2-3,6,11H,4-5,7H2,1H3,(H,14,15,16) |
| InChIKey | URZFTXWGLXIDAY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |