C13H20O3 — CID 11276154
(E)-1-[(1R,4S)-4-hydroxy-1,2,2-trimethylcyclopentyl]pent-2-ene-1,4-dione (PubChem CID 11276154) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (E)-1-[(1R,4S)-4-hydroxy-1,2,2-trimethylcyclopentyl]pent-2-ene-1,4-dione.
| Compound Name | (E)-1-[(1R,4S)-4-hydroxy-1,2,2-trimethylcyclopentyl]pent-2-ene-1,4-dione |
|---|---|
| PubChem CID | 11276154 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (E)-1-[(1R,4S)-4-hydroxy-1,2,2-trimethylcyclopentyl]pent-2-ene-1,4-dione |
| SMILES | CC(=O)/C=C/C(=O)[C@]1(C)C[C@@H](O)CC1(C)C |
| InChI | InChI=1S/C13H20O3/c1-9(14)5-6-11(16)13(4)8-10(15)7-12(13,2)3/h5-6,10,15H,7-8H2,1-4H3/b6-5+/t10-,13-/m0/s1 |
| InChIKey | UQAVZDROKSODIJ-BXQPDHIASA-N |
| XLogP | 1.89 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|