C15H28O2 — CID 143324005
(E)-1-(4-hydroxy-1,2,2-trimethylcyclopentyl)but-2-en-1-one;propane (PubChem CID 143324005) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (E)-1-(4-hydroxy-1,2,2-trimethylcyclopentyl)but-2-en-1-one;propane.
| Compound Name | (E)-1-(4-hydroxy-1,2,2-trimethylcyclopentyl)but-2-en-1-one;propane |
|---|---|
| PubChem CID | 143324005 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (E)-1-(4-hydroxy-1,2,2-trimethylcyclopentyl)but-2-en-1-one;propane |
| SMILES | C/C=C/C(=O)C1(C)CC(O)CC1(C)C.CCC |
| InChI | InChI=1S/C12H20O2.C3H8/c1-5-6-10(14)12(4)8-9(13)7-11(12,2)3;1-3-2/h5-6,9,13H,7-8H2,1-4H3;3H2,1-2H3/b6-5+; |
| InChIKey | PCIHXAPZXIQTRN-IPZCTEOASA-N |
| XLogP | 3.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|