C23H20F2N2O — CID 112769371
N-(2,6-difluorophenyl)-2-[ethyl(9H-fluoren-9-yl)amino]acetamide (PubChem CID 112769371) has the molecular formula C23H20F2N2O and a molecular weight of 378.42 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-[ethyl(9H-fluoren-9-yl)amino]acetamide.
| Compound Name | N-(2,6-difluorophenyl)-2-[ethyl(9H-fluoren-9-yl)amino]acetamide |
|---|---|
| PubChem CID | 112769371 |
| Molecular Formula | C23H20F2N2O |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-[ethyl(9H-fluoren-9-yl)amino]acetamide |
| SMILES | CCN(CC(=O)Nc1c(F)cccc1F)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H20F2N2O/c1-2-27(14-21(28)26-22-19(24)12-7-13-20(22)25)23-17-10-5-3-8-15(17)16-9-4-6-11-18(16)23/h3-13,23H,2,14H2,1H3,(H,26,28) |
| InChIKey | JONWWYNFFWACDY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |