C17H19F3N2O2 — CID 112771098
2-[1-(5-methylfuran-2-yl)ethylamino]-N-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 112771098) has the molecular formula C17H19F3N2O2 and a molecular weight of 340.35 g/mol. Its IUPAC name is 2-[1-(5-methylfuran-2-yl)ethylamino]-N-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[1-(5-methylfuran-2-yl)ethylamino]-N-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 112771098 |
| Molecular Formula | C17H19F3N2O2 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 2-[1-(5-methylfuran-2-yl)ethylamino]-N-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | Cc1ccc(C(C)NC(C)C(=O)Nc2ccc(C(F)(F)F)cc2)o1 |
| InChI | InChI=1S/C17H19F3N2O2/c1-10-4-9-15(24-10)11(2)21-12(3)16(23)22-14-7-5-13(6-8-14)17(18,19)20/h4-9,11-12,21H,1-3H3,(H,22,23) |
| InChIKey | DSSMQICASNLKDA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |