C22H24Cl2N4O4 — CID 112789979
N-[2-(2,5-dichloroanilino)-2-oxoethyl]-3-nitro-N-propyl-4-pyrrolidin-1-ylbenzamide (PubChem CID 112789979) has the molecular formula C22H24Cl2N4O4 and a molecular weight of 479.36 g/mol. Its IUPAC name is N-[2-(2,5-dichloroanilino)-2-oxoethyl]-3-nitro-N-propyl-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[2-(2,5-dichloroanilino)-2-oxoethyl]-3-nitro-N-propyl-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 112789979 |
| Molecular Formula | C22H24Cl2N4O4 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | N-[2-(2,5-dichloroanilino)-2-oxoethyl]-3-nitro-N-propyl-4-pyrrolidin-1-ylbenzamide |
| SMILES | CCCN(CC(=O)Nc1cc(Cl)ccc1Cl)C(=O)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H24Cl2N4O4/c1-2-9-27(14-21(29)25-18-13-16(23)6-7-17(18)24)22(30)15-5-8-19(20(12-15)28(31)32)26-10-3-4-11-26/h5-8,12-13H,2-4,9-11,14H2,1H3,(H,25,29) |
| InChIKey | FENJQFVUKAXDCQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|