C17H22FN3O3 — CID 11279085
2-ethoxyethyl (Z)-2-cyano-3-[(6-fluoro-3-pyridinyl)methylamino]-4-methylpent-2-enoate (PubChem CID 11279085) has the molecular formula C17H22FN3O3 and a molecular weight of 335.38 g/mol. Its IUPAC name is 2-ethoxyethyl (Z)-2-cyano-3-[(6-fluoro-3-pyridinyl)methylamino]-4-methylpent-2-enoate.
| Compound Name | 2-ethoxyethyl (Z)-2-cyano-3-[(6-fluoro-3-pyridinyl)methylamino]-4-methylpent-2-enoate |
|---|---|
| PubChem CID | 11279085 |
| Molecular Formula | C17H22FN3O3 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 2-ethoxyethyl (Z)-2-cyano-3-[(6-fluoro-3-pyridinyl)methylamino]-4-methylpent-2-enoate |
| SMILES | CCOCCOC(=O)/C(C#N)=C(\NCc1ccc(F)nc1)C(C)C |
| InChI | InChI=1S/C17H22FN3O3/c1-4-23-7-8-24-17(22)14(9-19)16(12(2)3)21-11-13-5-6-15(18)20-10-13/h5-6,10,12,21H,4,7-8,11H2,1-3H3/b16-14- |
| InChIKey | YZAJBRJTSVWVFI-PEZBUJJGSA-N |
| XLogP | 2.32 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|