C21H23Cl2N3O4 — CID 45277800
2-ethoxyethyl (Z)-2-cyano-3-[[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methylamino]-4-methylpent-2-enoate (PubChem CID 45277800) has the molecular formula C21H23Cl2N3O4 and a molecular weight of 452.34 g/mol. Its IUPAC name is 2-ethoxyethyl (Z)-2-cyano-3-[[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methylamino]-4-methylpent-2-enoate.
| Compound Name | 2-ethoxyethyl (Z)-2-cyano-3-[[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methylamino]-4-methylpent-2-enoate |
|---|---|
| PubChem CID | 45277800 |
| Molecular Formula | C21H23Cl2N3O4 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 2-ethoxyethyl (Z)-2-cyano-3-[[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methylamino]-4-methylpent-2-enoate |
| SMILES | CCOCCOC(=O)/C(C#N)=C(\NCc1cc(-c2ccc(Cl)cc2Cl)no1)C(C)C |
| InChI | InChI=1S/C21H23Cl2N3O4/c1-4-28-7-8-29-21(27)17(11-24)20(13(2)3)25-12-15-10-19(26-30-15)16-6-5-14(22)9-18(16)23/h5-6,9-10,13,25H,4,7-8,12H2,1-3H3/b20-17- |
| InChIKey | RHVKFRSKDMHGAI-JZJYNLBNSA-N |
| XLogP | 4.75 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|