C19H24ClN3O3 — CID 163952439
N-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl]-2-oxo-3-(propan-2-ylamino)hexanamide (PubChem CID 163952439) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is N-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl]-2-oxo-3-(propan-2-ylamino)hexanamide.
| Compound Name | N-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl]-2-oxo-3-(propan-2-ylamino)hexanamide |
|---|---|
| PubChem CID | 163952439 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]methyl]-2-oxo-3-(propan-2-ylamino)hexanamide |
| SMILES | CCCC(NC(C)C)C(=O)C(=O)NCc1cc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C19H24ClN3O3/c1-4-5-16(22-12(2)3)18(24)19(25)21-11-15-10-17(23-26-15)13-6-8-14(20)9-7-13/h6-10,12,16,22H,4-5,11H2,1-3H3,(H,21,25) |
| InChIKey | SAMHEPSUSVDBJC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|