C20H22N2O2S — CID 112798184
4-[4-(2,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-N,N-dimethylaniline (PubChem CID 112798184) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is 4-[4-(2,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[4-(2,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 112798184 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 4-[4-(2,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-N,N-dimethylaniline |
| SMILES | COc1ccc(-c2nc(-c3ccc(N(C)C)cc3)sc2C)c(OC)c1 |
| InChI | InChI=1S/C20H22N2O2S/c1-13-19(17-11-10-16(23-4)12-18(17)24-5)21-20(25-13)14-6-8-15(9-7-14)22(2)3/h6-12H,1-5H3 |
| InChIKey | LCIRRQFUWOSRPG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|