C20H21Cl2NO3 — CID 112803371
N-[2-(2,4-dichlorophenyl)ethyl]-2-(oxolan-2-ylmethoxy)benzamide (PubChem CID 112803371) has the molecular formula C20H21Cl2NO3 and a molecular weight of 394.30 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-2-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 112803371 |
| Molecular Formula | C20H21Cl2NO3 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-(oxolan-2-ylmethoxy)benzamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1Cl)c1ccccc1OCC1CCCO1 |
| InChI | InChI=1S/C20H21Cl2NO3/c21-15-8-7-14(18(22)12-15)9-10-23-20(24)17-5-1-2-6-19(17)26-13-16-4-3-11-25-16/h1-2,5-8,12,16H,3-4,9-11,13H2,(H,23,24) |
| InChIKey | VNJTXPODQFBARP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |