C17H21N3O3 — CID 94018328
N-(2-imidazol-1-ylethyl)-2-[[(2R)-oxolan-2-yl]methoxy]benzamide (PubChem CID 94018328) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-(2-imidazol-1-ylethyl)-2-[[(2R)-oxolan-2-yl]methoxy]benzamide.
| Compound Name | N-(2-imidazol-1-ylethyl)-2-[[(2R)-oxolan-2-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 94018328 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-(2-imidazol-1-ylethyl)-2-[[(2R)-oxolan-2-yl]methoxy]benzamide |
| SMILES | O=C(NCCn1ccnc1)c1ccccc1OC[C@H]1CCCO1 |
| InChI | InChI=1S/C17H21N3O3/c21-17(19-8-10-20-9-7-18-13-20)15-5-1-2-6-16(15)23-12-14-4-3-11-22-14/h1-2,5-7,9,13-14H,3-4,8,10-12H2,(H,19,21)/t14-/m1/s1 |
| InChIKey | UBNLSKXPYUSNSK-CQSZACIVSA-N |
| XLogP | 1.87 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |