C26H31N3O3S — CID 112804098
5-(1,3-benzothiazol-2-yl)-N-[1-(4-ethoxybenzoyl)piperidin-4-yl]pentanamide (PubChem CID 112804098) has the molecular formula C26H31N3O3S and a molecular weight of 465.62 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N-[1-(4-ethoxybenzoyl)piperidin-4-yl]pentanamide.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N-[1-(4-ethoxybenzoyl)piperidin-4-yl]pentanamide |
|---|---|
| PubChem CID | 112804098 |
| Molecular Formula | C26H31N3O3S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N-[1-(4-ethoxybenzoyl)piperidin-4-yl]pentanamide |
| SMILES | CCOc1ccc(C(=O)N2CCC(NC(=O)CCCCc3nc4ccccc4s3)CC2)cc1 |
| InChI | InChI=1S/C26H31N3O3S/c1-2-32-21-13-11-19(12-14-21)26(31)29-17-15-20(16-18-29)27-24(30)9-5-6-10-25-28-22-7-3-4-8-23(22)33-25/h3-4,7-8,11-14,20H,2,5-6,9-10,15-18H2,1H3,(H,27,30) |
| InChIKey | FHMBXIYEGOFYNE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|