C18H28N4O4S — CID 11280929
(2S)-1-[(2S)-6-amino-2-[[(2S)-2-amino-3-thiophen-3-ylpropanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 11280929) has the molecular formula C18H28N4O4S and a molecular weight of 396.51 g/mol. Its IUPAC name is (2S)-1-[(2S)-6-amino-2-[[(2S)-2-amino-3-thiophen-3-ylpropanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-6-amino-2-[[(2S)-2-amino-3-thiophen-3-ylpropanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 11280929 |
| Molecular Formula | C18H28N4O4S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (2S)-1-[(2S)-6-amino-2-[[(2S)-2-amino-3-thiophen-3-ylpropanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](N)Cc1ccsc1)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C18H28N4O4S/c19-7-2-1-4-14(17(24)22-8-3-5-15(22)18(25)26)21-16(23)13(20)10-12-6-9-27-11-12/h6,9,11,13-15H,1-5,7-8,10,19-20H2,(H,21,23)(H,25,26)/t13-,14-,15-/m0/s1 |
| InChIKey | JEMRVQYLVMUHQJ-KKUMJFAQSA-N |
| XLogP | 0.31 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|