C19H29NO8 — CID 11281002
ethyl 2-[2-(acetyloxymethyl)-3,4-dimethoxyphenyl]-2-(2,2-dimethoxyethylamino)acetate (PubChem CID 11281002) has the molecular formula C19H29NO8 and a molecular weight of 399.44 g/mol. Its IUPAC name is ethyl 2-[2-(acetyloxymethyl)-3,4-dimethoxyphenyl]-2-(2,2-dimethoxyethylamino)acetate.
| Compound Name | ethyl 2-[2-(acetyloxymethyl)-3,4-dimethoxyphenyl]-2-(2,2-dimethoxyethylamino)acetate |
|---|---|
| PubChem CID | 11281002 |
| Molecular Formula | C19H29NO8 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | ethyl 2-[2-(acetyloxymethyl)-3,4-dimethoxyphenyl]-2-(2,2-dimethoxyethylamino)acetate |
| SMILES | CCOC(=O)C(NCC(OC)OC)c1ccc(OC)c(OC)c1COC(C)=O |
| InChI | InChI=1S/C19H29NO8/c1-7-27-19(22)17(20-10-16(24-4)25-5)13-8-9-15(23-3)18(26-6)14(13)11-28-12(2)21/h8-9,16-17,20H,7,10-11H2,1-6H3 |
| InChIKey | JMBLBDMPOHMWMU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|