C19H14ClN3O4S — CID 112810219
3-chloro-N-[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]-1-benzothiophene-2-carboxamide (PubChem CID 112810219) has the molecular formula C19H14ClN3O4S and a molecular weight of 415.86 g/mol. Its IUPAC name is 3-chloro-N-[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 112810219 |
| Molecular Formula | C19H14ClN3O4S |
| Molecular Weight | 415.86 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 3-chloro-N-[2-(6-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCC(=O)N1CCc2ccc([N+](=O)[O-])cc21)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C19H14ClN3O4S/c20-17-13-3-1-2-4-15(13)28-18(17)19(25)21-10-16(24)22-8-7-11-5-6-12(23(26)27)9-14(11)22/h1-6,9H,7-8,10H2,(H,21,25) |
| InChIKey | IMDDICYONBWXMG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.86 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|