C18H17Cl3N2O2 — CID 112813669
(4-benzylpiperazin-1-yl)-(2,3,5-trichloro-6-hydroxyphenyl)methanone (PubChem CID 112813669) has the molecular formula C18H17Cl3N2O2 and a molecular weight of 399.71 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-(2,3,5-trichloro-6-hydroxyphenyl)methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-(2,3,5-trichloro-6-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 112813669 |
| Molecular Formula | C18H17Cl3N2O2 |
| Molecular Weight | 399.71 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-(2,3,5-trichloro-6-hydroxyphenyl)methanone |
| SMILES | O=C(c1c(O)c(Cl)cc(Cl)c1Cl)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H17Cl3N2O2/c19-13-10-14(20)17(24)15(16(13)21)18(25)23-8-6-22(7-9-23)11-12-4-2-1-3-5-12/h1-5,10,24H,6-9,11H2 |
| InChIKey | YBKKNPDWGVGGNZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.71 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|