C22H24N4O2 — CID 112814319
1-(2,3-diphenyl-3,4-dihydropyrazole-5-carbonyl)piperidine-2-carboxamide (PubChem CID 112814319) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-(2,3-diphenyl-3,4-dihydropyrazole-5-carbonyl)piperidine-2-carboxamide.
| Compound Name | 1-(2,3-diphenyl-3,4-dihydropyrazole-5-carbonyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 112814319 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 1-(2,3-diphenyl-3,4-dihydropyrazole-5-carbonyl)piperidine-2-carboxamide |
| SMILES | NC(=O)C1CCCCN1C(=O)C1=NN(c2ccccc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C22H24N4O2/c23-21(27)19-13-7-8-14-25(19)22(28)18-15-20(16-9-3-1-4-10-16)26(24-18)17-11-5-2-6-12-17/h1-6,9-12,19-20H,7-8,13-15H2,(H2,23,27) |
| InChIKey | BQBBZBBLXCACGF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |