C21H22ClN7O — CID 11281683
[(2S)-4-[7-(2-chloro-6-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-12-yl]piperazin-2-yl]methanol (PubChem CID 11281683) has the molecular formula C21H22ClN7O and a molecular weight of 423.91 g/mol. Its IUPAC name is [(2S)-4-[7-(2-chloro-6-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-12-yl]piperazin-2-yl]methanol.
| Compound Name | [(2S)-4-[7-(2-chloro-6-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-12-yl]piperazin-2-yl]methanol |
|---|---|
| PubChem CID | 11281683 |
| Molecular Formula | C21H22ClN7O |
| Molecular Weight | 423.91 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | [(2S)-4-[7-(2-chloro-6-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-12-yl]piperazin-2-yl]methanol |
| SMILES | Cc1cccc(Cl)c1Nc1nc2ccc(N3CCN[C@H](CO)C3)nc2n2cncc12 |
| InChI | InChI=1S/C21H22ClN7O/c1-13-3-2-4-15(22)19(13)27-20-17-9-23-12-29(17)21-16(25-20)5-6-18(26-21)28-8-7-24-14(10-28)11-30/h2-6,9,12,14,24,30H,7-8,10-11H2,1H3,(H,25,27)/t14-/m0/s1 |
| InChIKey | OOCDCJVAHKFZHI-AWEZNQCLSA-N |
| XLogP | 2.75 |
| TPSA | 90.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.91 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |