C20H21ClN6O3 — CID 68887175
12-[bis(2-hydroxyethyl)amino]-7-(2-chloro-6-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,11-pentaen-10-one (PubChem CID 68887175) has the molecular formula C20H21ClN6O3 and a molecular weight of 428.88 g/mol. Its IUPAC name is 12-[bis(2-hydroxyethyl)amino]-7-(2-chloro-6-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,11-pentaen-10-one.
| Compound Name | 12-[bis(2-hydroxyethyl)amino]-7-(2-chloro-6-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,11-pentaen-10-one |
|---|---|
| PubChem CID | 68887175 |
| Molecular Formula | C20H21ClN6O3 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 12-[bis(2-hydroxyethyl)amino]-7-(2-chloro-6-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,11-pentaen-10-one |
| SMILES | Cc1cccc(Cl)c1Nc1nc2c(=O)cc(N(CCO)CCO)[nH]c2n2cncc12 |
| InChI | InChI=1S/C20H21ClN6O3/c1-12-3-2-4-13(21)17(12)24-19-14-10-22-11-27(14)20-18(25-19)15(30)9-16(23-20)26(5-7-28)6-8-29/h2-4,9-11,28-29H,5-8H2,1H3,(H,23,30)(H,24,25) |
| InChIKey | KHXIXSWGRYLVRC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 118.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |