C23H26ClN7O2 — CID 19605710
3-[4-[7-(2-chloro-6-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-12-yl]piperazin-1-yl]propane-1,2-diol (PubChem CID 19605710) has the molecular formula C23H26ClN7O2 and a molecular weight of 467.96 g/mol. Its IUPAC name is 3-[4-[7-(2-chloro-6-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-12-yl]piperazin-1-yl]propane-1,2-diol.
| Compound Name | 3-[4-[7-(2-chloro-6-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-12-yl]piperazin-1-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 19605710 |
| Molecular Formula | C23H26ClN7O2 |
| Molecular Weight | 467.96 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 3-[4-[7-(2-chloro-6-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-12-yl]piperazin-1-yl]propane-1,2-diol |
| SMILES | Cc1cccc(Cl)c1Nc1nc2ccc(N3CCN(CC(O)CO)CC3)nc2n2cncc12 |
| InChI | InChI=1S/C23H26ClN7O2/c1-15-3-2-4-17(24)21(15)28-22-19-11-25-14-31(19)23-18(26-22)5-6-20(27-23)30-9-7-29(8-10-30)12-16(33)13-32/h2-6,11,14,16,32-33H,7-10,12-13H2,1H3,(H,26,28) |
| InChIKey | HIWJFHBGLTVRII-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 102.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.96 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |